About 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid
4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid (PubChem CID 18316634) has the molecular formula C13H13NO6
and a molecular weight of 279.25 g/mol. Its IUPAC name is 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid.
Molecular Properties
| Compound Name | 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid |
| PubChem CID | 18316634 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid |
| SMILES | COc1ccc(C(=O)O)c2oc(C3(C)OCCO3)nc12 |
| InChI | InChI=1S/C13H13NO6/c1-13(18-5-6-19-13)12-14-9-8(17-2)4-3-7(11(15)16)10(9)20-12/h3-4H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | JJVZLSYZTLZUNL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid?
The IUPAC name of 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid (CID 18316634) is 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid.
What is the SMILES notation for 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid?
The canonical SMILES for 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid is COc1ccc(C(=O)O)c2oc(C3(C)OCCO3)nc12.
What is the InChIKey of 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid?
The InChIKey is JJVZLSYZTLZUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO6/c1-13(18-5-6-19-13)12-14-9-8(17-2)4-3-7(11(15)16)10(9)20-12/h3-4H,5-6H2,1-2H3,(H,15,16).
What are the key properties of 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid?
4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid has a molecular weight of 279.25 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-1,3-benzoxazole-7-carboxylic acid is sourced from PubChem (CID 18316634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).