About N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide
N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide (PubChem CID 18316769) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide |
| PubChem CID | 18316769 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C)c(C2CO2)cc1C |
| InChI | InChI=1S/C12H15NO2/c1-7-5-11(13-9(3)14)8(2)4-10(7)12-6-15-12/h4-5,12H,6H2,1-3H3,(H,13,14) |
| InChIKey | PZROYGOIIRJMCZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide?
The IUPAC name of N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide (CID 18316769) is N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide.
What is the SMILES notation for N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide?
The canonical SMILES for N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide is CC(=O)Nc1cc(C)c(C2CO2)cc1C.
What is the InChIKey of N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide?
The InChIKey is PZROYGOIIRJMCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-7-5-11(13-9(3)14)8(2)4-10(7)12-6-15-12/h4-5,12H,6H2,1-3H3,(H,13,14).
What are the key properties of N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide?
N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide has a molecular weight of 205.26 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-dimethyl-4-(oxiran-2-yl)phenyl]acetamide is sourced from PubChem (CID 18316769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).