About 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one
7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 18317464) has the molecular formula C16H15ClN2O
and a molecular weight of 286.76 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one.
Molecular Properties
| Compound Name | 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one |
| PubChem CID | 18317464 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | Cc1nc(C)c2c(n1)CC(c1ccccc1Cl)CC2=O |
| InChI | InChI=1S/C16H15ClN2O/c1-9-16-14(19-10(2)18-9)7-11(8-15(16)20)12-5-3-4-6-13(12)17/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | RBOYSWOSVOWRTE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one?
The IUPAC name of 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one (CID 18317464) is 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one.
What is the SMILES notation for 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one?
The canonical SMILES for 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one is Cc1nc(C)c2c(n1)CC(c1ccccc1Cl)CC2=O.
What is the InChIKey of 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one?
The InChIKey is RBOYSWOSVOWRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN2O/c1-9-16-14(19-10(2)18-9)7-11(8-15(16)20)12-5-3-4-6-13(12)17/h3-6,11H,7-8H2,1-2H3.
What are the key properties of 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one?
7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one has a molecular weight of 286.76 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chlorophenyl)-2,4-dimethyl-7,8-dihydro-6H-quinazolin-5-one is sourced from PubChem (CID 18317464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).