C15H15Cl2N5OS — CID 18317577
2-[(Z)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-1-oxido-7,8-dihydro-6H-quinolin-1-ium-5-ylidene]amino]guanidine (PubChem CID 18317577) has the molecular formula C15H15Cl2N5OS and a molecular weight of 384.29 g/mol. Its IUPAC name is 2-[(Z)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-1-oxido-7,8-dihydro-6H-quinolin-1-ium-5-ylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-1-oxido-7,8-dihydro-6H-quinolin-1-ium-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 18317577 |
| Molecular Formula | C15H15Cl2N5OS |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-[(Z)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-1-oxido-7,8-dihydro-6H-quinolin-1-ium-5-ylidene]amino]guanidine |
| SMILES | Cc1cc[n+]([O-])c2c1/C(=N\N=C(N)N)CC(c1cc(Cl)sc1Cl)C2 |
| InChI | InChI=1S/C15H15Cl2N5OS/c1-7-2-3-22(23)11-5-8(9-6-12(16)24-14(9)17)4-10(13(7)11)20-21-15(18)19/h2-3,6,8H,4-5H2,1H3,(H4,18,19,21)/b20-10- |
| InChIKey | NFNZMOILAUGVIR-JMIUGGIZSA-N |
| XLogP | 2.70 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|