C17H19ClN2O2 — CID 18317957
1-(6-chloro-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylic acid (PubChem CID 18317957) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 1-(6-chloro-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(6-chloro-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 18317957 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-(6-chloro-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylic acid |
| SMILES | Cn1c2c(c3cc(Cl)ccc31)CCNC2C1(C(=O)O)CCC1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-20-13-4-3-10(18)9-12(13)11-5-8-19-15(14(11)20)17(16(21)22)6-2-7-17/h3-4,9,15,19H,2,5-8H2,1H3,(H,21,22) |
| InChIKey | HTHYDQSBWOMGNX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|