About 6-ethoxy-2,2-dimethyl-1H-quinoline
6-ethoxy-2,2-dimethyl-1H-quinoline (PubChem CID 18318065) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-ethoxy-2,2-dimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-ethoxy-2,2-dimethyl-1H-quinoline |
| PubChem CID | 18318065 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-ethoxy-2,2-dimethyl-1H-quinoline |
| SMILES | CCOc1ccc2c(c1)C=CC(C)(C)N2 |
| InChI | InChI=1S/C13H17NO/c1-4-15-11-5-6-12-10(9-11)7-8-13(2,3)14-12/h5-9,14H,4H2,1-3H3 |
| InChIKey | RSJOCYQSNCNVNV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-2,2-dimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2,2-dimethyl-1H-quinoline?
The IUPAC name of 6-ethoxy-2,2-dimethyl-1H-quinoline (CID 18318065) is 6-ethoxy-2,2-dimethyl-1H-quinoline.
What is the SMILES notation for 6-ethoxy-2,2-dimethyl-1H-quinoline?
The canonical SMILES for 6-ethoxy-2,2-dimethyl-1H-quinoline is CCOc1ccc2c(c1)C=CC(C)(C)N2.
What is the InChIKey of 6-ethoxy-2,2-dimethyl-1H-quinoline?
The InChIKey is RSJOCYQSNCNVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-4-15-11-5-6-12-10(9-11)7-8-13(2,3)14-12/h5-9,14H,4H2,1-3H3.
What are the key properties of 6-ethoxy-2,2-dimethyl-1H-quinoline?
6-ethoxy-2,2-dimethyl-1H-quinoline has a molecular weight of 203.28 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,2-dimethyl-1H-quinoline is sourced from PubChem (CID 18318065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).