C14H24F3NO4 — CID 18318111
ethyl 4-butylpiperidine-4-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 18318111) has the molecular formula C14H24F3NO4 and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl 4-butylpiperidine-4-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 4-butylpiperidine-4-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18318111 |
| Molecular Formula | C14H24F3NO4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | ethyl 4-butylpiperidine-4-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC1(C(=O)OCC)CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H23NO2.C2HF3O2/c1-3-5-6-12(11(14)15-4-2)7-9-13-10-8-12;3-2(4,5)1(6)7/h13H,3-10H2,1-2H3;(H,6,7) |
| InChIKey | AQDWZVRRSHOWOB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |