C35H39NO6S — CID 18318543
3-[[4-(cyclopentylmethyl)phenyl]methyl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-ol;oxalic acid (PubChem CID 18318543) has the molecular formula C35H39NO6S and a molecular weight of 601.77 g/mol. Its IUPAC name is 3-[[4-(cyclopentylmethyl)phenyl]methyl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-ol;oxalic acid.
| Compound Name | 3-[[4-(cyclopentylmethyl)phenyl]methyl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-ol;oxalic acid |
|---|---|
| PubChem CID | 18318543 |
| Molecular Formula | C35H39NO6S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 3-[[4-(cyclopentylmethyl)phenyl]methyl]-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-ol;oxalic acid |
| SMILES | O=C(O)C(=O)O.Oc1ccc2c(Cc3ccc(CC4CCCC4)cc3)c(-c3ccc(OCCN4CCCC4)cc3)sc2c1 |
| InChI | InChI=1S/C33H37NO2S.C2H2O4/c35-28-13-16-30-31(22-26-9-7-25(8-10-26)21-24-5-1-2-6-24)33(37-32(30)23-28)27-11-14-29(15-12-27)36-20-19-34-17-3-4-18-34;3-1(4)2(5)6/h7-16,23-24,35H,1-6,17-22H2;(H,3,4)(H,5,6) |
| InChIKey | YWNBNFJUYQGHSH-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|