About bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene
bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene (PubChem CID 18318750) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene |
| PubChem CID | 18318750 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene |
| SMILES | C1=C2CCC(C1)C2.CCCCC1=C2CCC(C1)C2 |
| InChI | InChI=1S/C11H18.C7H10/c1-2-3-4-10-7-9-5-6-11(10)8-9;1-2-7-4-3-6(1)5-7/h9H,2-8H2,1H3;1,7H,2-5H2 |
| InChIKey | MFVXESSAEAOFHA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene?
The IUPAC name of bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene (CID 18318750) is bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene.
What is the SMILES notation for bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene?
The canonical SMILES for bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene is C1=C2CCC(C1)C2.CCCCC1=C2CCC(C1)C2.
What is the InChIKey of bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene?
The InChIKey is MFVXESSAEAOFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18.C7H10/c1-2-3-4-10-7-9-5-6-11(10)8-9;1-2-7-4-3-6(1)5-7/h9H,2-8H2,1H3;1,7H,2-5H2.
What are the key properties of bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene?
bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene has a molecular weight of 244.42 g/mol, XLogP of 5.79, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-1-ene;2-butylbicyclo[2.2.1]hept-1-ene is sourced from PubChem (CID 18318750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).