C26H33N3O5 — CID 18318948
2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid (PubChem CID 18318948) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid.
| Compound Name | 2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 18318948 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoic acid |
| SMILES | CN1C(=O)N(CCCC(C/C(=N/O)c2ccc3c(c2)CC2=C3CCCC2)C(=O)O)C(=O)C1(C)C |
| InChI | InChI=1S/C26H33N3O5/c1-26(2)24(32)29(25(33)28(26)3)12-6-8-18(23(30)31)15-22(27-34)17-10-11-21-19(14-17)13-16-7-4-5-9-20(16)21/h10-11,14,18,34H,4-9,12-13,15H2,1-3H3,(H,30,31)/b27-22- |
| InChIKey | JHGUDNRHUSOZEF-QYQHSDTDSA-N |
| XLogP | 4.29 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|