C12H19NO — CID 18320088
2-[(dimethylamino)methyl]-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one (PubChem CID 18320088) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one.
| Compound Name | 2-[(dimethylamino)methyl]-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
|---|---|
| PubChem CID | 18320088 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-[(dimethylamino)methyl]-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
| SMILES | C=C1CC(C)(C)C=C(CN(C)C)C1=O |
| InChI | InChI=1S/C12H19NO/c1-9-6-12(2,3)7-10(11(9)14)8-13(4)5/h7H,1,6,8H2,2-5H3 |
| InChIKey | CIMMRMLFVCKDLQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|