C12H19NO2 — CID 18320173
N-(2,2-dimethyl-5-oxocyclohex-3-en-1-yl)butanamide (PubChem CID 18320173) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2,2-dimethyl-5-oxocyclohex-3-en-1-yl)butanamide.
| Compound Name | N-(2,2-dimethyl-5-oxocyclohex-3-en-1-yl)butanamide |
|---|---|
| PubChem CID | 18320173 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(2,2-dimethyl-5-oxocyclohex-3-en-1-yl)butanamide |
| SMILES | CCCC(=O)NC1CC(=O)C=CC1(C)C |
| InChI | InChI=1S/C12H19NO2/c1-4-5-11(15)13-10-8-9(14)6-7-12(10,2)3/h6-7,10H,4-5,8H2,1-3H3,(H,13,15) |
| InChIKey | ATOTVWIGANHZFW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |