About 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one
2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one (PubChem CID 18320299) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one |
| PubChem CID | 18320299 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)C=C(c2ncc[nH]2)C(=O)CC1 |
| InChI | InChI=1S/C11H14N2O/c1-11(2)4-3-9(14)8(7-11)10-12-5-6-13-10/h5-7H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | HUZPSLOTYXIYMC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one?
The IUPAC name of 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one (CID 18320299) is 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one is CC1(C)C=C(c2ncc[nH]2)C(=O)CC1.
What is the InChIKey of 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one?
The InChIKey is HUZPSLOTYXIYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-11(2)4-3-9(14)8(7-11)10-12-5-6-13-10/h5-7H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one?
2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one has a molecular weight of 190.25 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-yl)-4,4-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 18320299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).