About 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one
2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one (PubChem CID 18320326) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
| PubChem CID | 18320326 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
| SMILES | C=C1CC(C)(C)C=C(CN(CC)CC)C1=O |
| InChI | InChI=1S/C14H23NO/c1-6-15(7-2)10-12-9-14(4,5)8-11(3)13(12)16/h9H,3,6-8,10H2,1-2,4-5H3 |
| InChIKey | OUQYUHXLYSFIKO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
The IUPAC name of 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one (CID 18320326) is 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one.
What is the SMILES notation for 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
The canonical SMILES for 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one is C=C1CC(C)(C)C=C(CN(CC)CC)C1=O.
What is the InChIKey of 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
The InChIKey is OUQYUHXLYSFIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-6-15(7-2)10-12-9-14(4,5)8-11(3)13(12)16/h9H,3,6-8,10H2,1-2,4-5H3.
What are the key properties of 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one has a molecular weight of 221.34 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one is sourced from PubChem (CID 18320326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).