About 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one
6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one (PubChem CID 18320373) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one |
| PubChem CID | 18320373 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one |
| SMILES | CN(C)C1CC(C)(C)C=CC1=O |
| InChI | InChI=1S/C10H17NO/c1-10(2)6-5-9(12)8(7-10)11(3)4/h5-6,8H,7H2,1-4H3 |
| InChIKey | IKWINLZSUJOCOB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one?
The IUPAC name of 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one (CID 18320373) is 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one is CN(C)C1CC(C)(C)C=CC1=O.
What is the InChIKey of 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one?
The InChIKey is IKWINLZSUJOCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-10(2)6-5-9(12)8(7-10)11(3)4/h5-6,8H,7H2,1-4H3.
What are the key properties of 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one?
6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one has a molecular weight of 167.25 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-4,4-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 18320373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).