About 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one
3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one (PubChem CID 18320396) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
| PubChem CID | 18320396 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
| SMILES | C=C1CC(C)(C)C(CNCC)=CC1=O |
| InChI | InChI=1S/C12H19NO/c1-5-13-8-10-6-11(14)9(2)7-12(10,3)4/h6,13H,2,5,7-8H2,1,3-4H3 |
| InChIKey | ZQLKBAFFPGAPJF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
The IUPAC name of 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one (CID 18320396) is 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one.
What is the SMILES notation for 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
The canonical SMILES for 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one is C=C1CC(C)(C)C(CNCC)=CC1=O.
What is the InChIKey of 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
The InChIKey is ZQLKBAFFPGAPJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-5-13-8-10-6-11(14)9(2)7-12(10,3)4/h6,13H,2,5,7-8H2,1,3-4H3.
What are the key properties of 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one?
3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one has a molecular weight of 193.29 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one is sourced from PubChem (CID 18320396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).