About [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium
[3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium (PubChem CID 18320550) has the molecular formula C17H27ClO6P+
and a molecular weight of 393.82 g/mol. Its IUPAC name is [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium.
Molecular Properties
| Compound Name | [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium |
| PubChem CID | 18320550 |
| Molecular Formula | C17H27ClO6P+ |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium |
| SMILES | CCO[P+](=O)OCC.COCc1cc(Cl)cc(OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H17ClO3.C4H10O3P/c1-13(2,3)12(15)17-11-6-9(8-16-4)5-10(14)7-11;1-3-6-8(5)7-4-2/h5-7H,8H2,1-4H3;3-4H2,1-2H3/q;+1 |
| InChIKey | GTAWHPYNNZCBCF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium?
The IUPAC name of [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium (CID 18320550) is [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium.
What is the SMILES notation for [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium?
The canonical SMILES for [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium is CCO[P+](=O)OCC.COCc1cc(Cl)cc(OC(=O)C(C)(C)C)c1.
What is the InChIKey of [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium?
The InChIKey is GTAWHPYNNZCBCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO3.C4H10O3P/c1-13(2,3)12(15)17-11-6-9(8-16-4)5-10(14)7-11;1-3-6-8(5)7-4-2/h5-7H,8H2,1-4H3;3-4H2,1-2H3/q;+1.
What are the key properties of [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium?
[3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium has a molecular weight of 393.82 g/mol, XLogP of 5.15, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;diethoxy(oxo)phosphanium is sourced from PubChem (CID 18320550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).