C12H17N3 — CID 18320572
1-N,1-N,7-N,7-N-tetramethylindole-1,7-diamine (PubChem CID 18320572) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-N,1-N,7-N,7-N-tetramethylindole-1,7-diamine.
| Compound Name | 1-N,1-N,7-N,7-N-tetramethylindole-1,7-diamine |
|---|---|
| PubChem CID | 18320572 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-N,1-N,7-N,7-N-tetramethylindole-1,7-diamine |
| SMILES | CN(C)c1cccc2ccn(N(C)C)c12 |
| InChI | InChI=1S/C12H17N3/c1-13(2)11-7-5-6-10-8-9-15(12(10)11)14(3)4/h5-9H,1-4H3 |
| InChIKey | ALBCWUMHZNKZNS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |