C26H33Cl2NO4 — CID 18320829
[4-[bis(2-chloroethyl)amino]phenyl] 3-(1,4-dimethyl-2,5-dioxo-6-prop-2-enylcyclohex-3-en-1-yl)-3-methylbutanoate (PubChem CID 18320829) has the molecular formula C26H33Cl2NO4 and a molecular weight of 494.46 g/mol. Its IUPAC name is [4-[bis(2-chloroethyl)amino]phenyl] 3-(1,4-dimethyl-2,5-dioxo-6-prop-2-enylcyclohex-3-en-1-yl)-3-methylbutanoate.
| Compound Name | [4-[bis(2-chloroethyl)amino]phenyl] 3-(1,4-dimethyl-2,5-dioxo-6-prop-2-enylcyclohex-3-en-1-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 18320829 |
| Molecular Formula | C26H33Cl2NO4 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [4-[bis(2-chloroethyl)amino]phenyl] 3-(1,4-dimethyl-2,5-dioxo-6-prop-2-enylcyclohex-3-en-1-yl)-3-methylbutanoate |
| SMILES | C=CCC1C(=O)C(C)=CC(=O)C1(C)C(C)(C)CC(=O)Oc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C26H33Cl2NO4/c1-6-7-21-24(32)18(2)16-22(30)26(21,5)25(3,4)17-23(31)33-20-10-8-19(9-11-20)29(14-12-27)15-13-28/h6,8-11,16,21H,1,7,12-15,17H2,2-5H3 |
| InChIKey | HKSOBCYSJNTZTK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|