C17H41N3 — CID 18320903
3-N-(2-aminoethyl)-2-N,2-N,2-trimethylbutane-2,3-diamine;octane (PubChem CID 18320903) has the molecular formula C17H41N3 and a molecular weight of 287.54 g/mol. Its IUPAC name is 3-N-(2-aminoethyl)-2-N,2-N,2-trimethylbutane-2,3-diamine;octane.
| Compound Name | 3-N-(2-aminoethyl)-2-N,2-N,2-trimethylbutane-2,3-diamine;octane |
|---|---|
| PubChem CID | 18320903 |
| Molecular Formula | C17H41N3 |
| Molecular Weight | 287.54 g/mol |
| Exact Mass | 287.33 |
| IUPAC Name | 3-N-(2-aminoethyl)-2-N,2-N,2-trimethylbutane-2,3-diamine;octane |
| SMILES | CC(NCCN)C(C)(C)N(C)C.CCCCCCCC |
| InChI | InChI=1S/C9H23N3.C8H18/c1-8(11-7-6-10)9(2,3)12(4)5;1-3-5-7-8-6-4-2/h8,11H,6-7,10H2,1-5H3;3-8H2,1-2H3 |
| InChIKey | PTAIPRNVZXQBJZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|