About 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one
5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one (PubChem CID 18321433) has the molecular formula C16H15F6N3O
and a molecular weight of 379.30 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one |
| PubChem CID | 18321433 |
| Molecular Formula | C16H15F6N3O |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one |
| SMILES | O=c1[nH]c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1C1CCNCC1 |
| InChI | InChI=1S/C16H15F6N3O/c17-15(18,19)10-5-9(6-11(7-10)16(20,21)22)13-8-25(14(26)24-13)12-1-3-23-4-2-12/h5-8,12,23H,1-4H2,(H,24,26) |
| InChIKey | GXIMVXGABSVIQV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one (CID 18321433) is 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one is O=c1[nH]c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1C1CCNCC1.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one?
The InChIKey is GXIMVXGABSVIQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F6N3O/c17-15(18,19)10-5-9(6-11(7-10)16(20,21)22)13-8-25(14(26)24-13)12-1-3-23-4-2-12/h5-8,12,23H,1-4H2,(H,24,26).
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one?
5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one has a molecular weight of 379.30 g/mol, XLogP of 3.81, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]-3-piperidin-4-yl-1H-imidazol-2-one is sourced from PubChem (CID 18321433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).