C15H21N3O — CID 18321635
3-amino-5-cyclohexyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 18321635) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-amino-5-cyclohexyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | 3-amino-5-cyclohexyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 18321635 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-amino-5-cyclohexyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | NC1CN(C2CCCCC2)c2ccccc2NC1=O |
| InChI | InChI=1S/C15H21N3O/c16-12-10-18(11-6-2-1-3-7-11)14-9-5-4-8-13(14)17-15(12)19/h4-5,8-9,11-12H,1-3,6-7,10,16H2,(H,17,19) |
| InChIKey | XDDTWCUPTRCNKL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |