About (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid
(E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid (PubChem CID 18321745) has the molecular formula C10H17F2NO2
and a molecular weight of 221.25 g/mol. Its IUPAC name is (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid.
Molecular Properties
| Compound Name | (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid |
| PubChem CID | 18321745 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid |
| SMILES | CN(C)CCCCC(F)(F)/C=C/C(=O)O |
| InChI | InChI=1S/C10H17F2NO2/c1-13(2)8-4-3-6-10(11,12)7-5-9(14)15/h5,7H,3-4,6,8H2,1-2H3,(H,14,15)/b7-5+ |
| InChIKey | ROFBGEBOZYQKEF-FNORWQNLSA-N |
| XLogP | 1.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid?
The IUPAC name of (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid (CID 18321745) is (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid.
What is the SMILES notation for (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid?
The canonical SMILES for (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid is CN(C)CCCCC(F)(F)/C=C/C(=O)O.
What is the InChIKey of (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid?
The InChIKey is ROFBGEBOZYQKEF-FNORWQNLSA-N. The full InChI is InChI=1S/C10H17F2NO2/c1-13(2)8-4-3-6-10(11,12)7-5-9(14)15/h5,7H,3-4,6,8H2,1-2H3,(H,14,15)/b7-5+.
What are the key properties of (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid?
(E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid has a molecular weight of 221.25 g/mol, XLogP of 1.99, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-(dimethylamino)-4,4-difluorooct-2-enoic acid is sourced from PubChem (CID 18321745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).