C21H21N2O3- — CID 18321984
2-[5-[2-(4,4-diethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate (PubChem CID 18321984) has the molecular formula C21H21N2O3- and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[5-[2-(4,4-diethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate.
| Compound Name | 2-[5-[2-(4,4-diethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 18321984 |
| Molecular Formula | C21H21N2O3- |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[5-[2-(4,4-diethyl-2,3-dihydrochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
| SMILES | CCC1(CC)CCOc2ccc(C#Cc3cnc(CC(=O)[O-])nc3)cc21 |
| InChI | InChI=1S/C21H22N2O3/c1-3-21(4-2)9-10-26-18-8-7-15(11-17(18)21)5-6-16-13-22-19(23-14-16)12-20(24)25/h7-8,11,13-14H,3-4,9-10,12H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | BXKCOWKPNJWQOP-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|