C22H24N2O2S — CID 18322027
2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid (PubChem CID 18322027) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid.
| Compound Name | 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 18322027 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid |
| SMILES | CCC1(CC)CCSc2cc(C)c(C#Cc3cnc(CC(=O)O)nc3)cc21 |
| InChI | InChI=1S/C22H24N2O2S/c1-4-22(5-2)8-9-27-19-10-15(3)17(11-18(19)22)7-6-16-13-23-20(24-14-16)12-21(25)26/h10-11,13-14H,4-5,8-9,12H2,1-3H3,(H,25,26) |
| InChIKey | AKUOAIILSCIZRT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|