C22H24O3S — CID 18322029
2-[3-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid (PubChem CID 18322029) has the molecular formula C22H24O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[3-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[3-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 18322029 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[3-[2-(4,4-diethyl-7-methyl-2,3-dihydrochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid |
| SMILES | CCC1(CC)CCOc2cc(C)c(C#Cc3ccsc3CC(=O)O)cc21 |
| InChI | InChI=1S/C22H24O3S/c1-4-22(5-2)9-10-25-19-12-15(3)17(13-18(19)22)7-6-16-8-11-26-20(16)14-21(23)24/h8,11-13H,4-5,9-10,14H2,1-3H3,(H,23,24) |
| InChIKey | QHBZFNZUTREAKG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|