C23H26O2S2 — CID 18322059
2-[5-[2-(4,4,7-triethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid (PubChem CID 18322059) has the molecular formula C23H26O2S2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 2-[5-[2-(4,4,7-triethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[2-(4,4,7-triethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 18322059 |
| Molecular Formula | C23H26O2S2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[5-[2-(4,4,7-triethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid |
| SMILES | CCc1cc2c(cc1C#Cc1ccc(CC(=O)O)s1)C(CC)(CC)CCS2 |
| InChI | InChI=1S/C23H26O2S2/c1-4-16-14-21-20(23(5-2,6-3)11-12-26-21)13-17(16)7-8-18-9-10-19(27-18)15-22(24)25/h9-10,13-14H,4-6,11-12,15H2,1-3H3,(H,24,25) |
| InChIKey | IGPVOCKBKRZAEE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|