About ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate
ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate (PubChem CID 18322071) has the molecular formula C27H34N2O2S
and a molecular weight of 450.65 g/mol. Its IUPAC name is ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate.
Molecular Properties
| Compound Name | ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
| PubChem CID | 18322071 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ncc(C#Cc2cc3c(cc2C)SCCC3(CC)CC)cn1 |
| InChI | InChI=1S/C27H34N2O2S/c1-5-27(6-2)14-15-32-24-16-20(4)22(17-23(24)27)13-12-21-18-28-25(29-19-21)10-8-9-11-26(30)31-7-3/h16-19H,5-11,14-15H2,1-4H3 |
| InChIKey | GYFHKYOFHLDYBP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate?
The IUPAC name of ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate (CID 18322071) is ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate.
What is the SMILES notation for ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate?
The canonical SMILES for ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate is CCOC(=O)CCCCc1ncc(C#Cc2cc3c(cc2C)SCCC3(CC)CC)cn1.
What is the InChIKey of ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate?
The InChIKey is GYFHKYOFHLDYBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34N2O2S/c1-5-27(6-2)14-15-32-24-16-20(4)22(17-23(24)27)13-12-21-18-28-25(29-19-21)10-8-9-11-26(30)31-7-3/h16-19H,5-11,14-15H2,1-4H3.
What are the key properties of ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate?
ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate has a molecular weight of 450.65 g/mol, XLogP of 6.01, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate is sourced from PubChem (CID 18322071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).