C22H23N2O2S- — CID 18322092
2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate (PubChem CID 18322092) has the molecular formula C22H23N2O2S- and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate.
| Compound Name | 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
|---|---|
| PubChem CID | 18322092 |
| Molecular Formula | C22H23N2O2S- |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
| SMILES | CCC1(CC)CCSc2cc(C)c(C#Cc3cnc(CC(=O)[O-])cn3)cc21 |
| InChI | InChI=1S/C22H24N2O2S/c1-4-22(5-2)8-9-27-20-10-15(3)16(11-19(20)22)6-7-17-13-24-18(14-23-17)12-21(25)26/h10-11,13-14H,4-5,8-9,12H2,1-3H3,(H,25,26)/p-1 |
| InChIKey | RETAZLUQYLBNFK-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|