C21H22N2O2S — CID 18322097
2-[5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid (PubChem CID 18322097) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid.
| Compound Name | 2-[5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 18322097 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetic acid |
| SMILES | CCC1(CC)CCSc2ccc(C#Cc3cnc(CC(=O)O)nc3)cc21 |
| InChI | InChI=1S/C21H22N2O2S/c1-3-21(4-2)9-10-26-18-8-7-15(11-17(18)21)5-6-16-13-22-19(23-14-16)12-20(24)25/h7-8,11,13-14H,3-4,9-10,12H2,1-2H3,(H,24,25) |
| InChIKey | ATQVPRFQNRUXAD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|