C23H25N2O2S- — CID 18322116
2-[5-[2-(2,2,7-triethyl-3,4-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate (PubChem CID 18322116) has the molecular formula C23H25N2O2S- and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[5-[2-(2,2,7-triethyl-3,4-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate.
| Compound Name | 2-[5-[2-(2,2,7-triethyl-3,4-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
|---|---|
| PubChem CID | 18322116 |
| Molecular Formula | C23H25N2O2S- |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[5-[2-(2,2,7-triethyl-3,4-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
| SMILES | CCc1cc2c(cc1C#Cc1cnc(CC(=O)[O-])cn1)CCC(CC)(CC)S2 |
| InChI | InChI=1S/C23H26N2O2S/c1-4-16-12-21-18(9-10-23(5-2,6-3)28-21)11-17(16)7-8-19-14-25-20(15-24-19)13-22(26)27/h11-12,14-15H,4-6,9-10,13H2,1-3H3,(H,26,27)/p-1 |
| InChIKey | GVODHZRCMFKICZ-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|