C22H24O2S2 — CID 18322131
2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid (PubChem CID 18322131) has the molecular formula C22H24O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 18322131 |
| Molecular Formula | C22H24O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl]acetic acid |
| SMILES | CCC1(CC)CCSc2cc(C)c(C#Cc3ccc(CC(=O)O)s3)cc21 |
| InChI | InChI=1S/C22H24O2S2/c1-4-22(5-2)10-11-25-20-12-15(3)16(13-19(20)22)6-7-17-8-9-18(26-17)14-21(23)24/h8-9,12-13H,4-5,10-11,14H2,1-3H3,(H,23,24) |
| InChIKey | LMHULCUYSIANSE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|