C18H24ClF3N4O5 — CID 18322204
2-[3-[3-chloro-5-(piperidine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid (PubChem CID 18322204) has the molecular formula C18H24ClF3N4O5 and a molecular weight of 468.86 g/mol. Its IUPAC name is 2-[3-[3-chloro-5-(piperidine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-[3-chloro-5-(piperidine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18322204 |
| Molecular Formula | C18H24ClF3N4O5 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[3-[3-chloro-5-(piperidine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NOCCCOc1cc(Cl)cc(C(=O)N2CCCCC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23ClN4O3.C2HF3O2/c17-13-9-12(15(22)21-5-2-1-3-6-21)10-14(11-13)23-7-4-8-24-20-16(18)19;3-2(4,5)1(6)7/h9-11H,1-8H2,(H4,18,19,20);(H,6,7) |
| InChIKey | QDFCQMLIGLOWFJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|