C22H26ClF3N6O5 — CID 18322214
2-[3-[3-chloro-5-(4-pyridin-4-ylpiperazine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid (PubChem CID 18322214) has the molecular formula C22H26ClF3N6O5 and a molecular weight of 546.93 g/mol. Its IUPAC name is 2-[3-[3-chloro-5-(4-pyridin-4-ylpiperazine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-[3-chloro-5-(4-pyridin-4-ylpiperazine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18322214 |
| Molecular Formula | C22H26ClF3N6O5 |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 2-[3-[3-chloro-5-(4-pyridin-4-ylpiperazine-1-carbonyl)phenoxy]propoxy]guanidine;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NOCCCOc1cc(Cl)cc(C(=O)N2CCN(c3ccncc3)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25ClN6O3.C2HF3O2/c21-16-12-15(13-18(14-16)29-10-1-11-30-25-20(22)23)19(28)27-8-6-26(7-9-27)17-2-4-24-5-3-17;3-2(4,5)1(6)7/h2-5,12-14H,1,6-11H2,(H4,22,23,25);(H,6,7) |
| InChIKey | SXCVOIQOSNTTQF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 156.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|