About trimethyl silylcyclopentadiene
trimethyl silylcyclopentadiene (PubChem CID 18322651) has the molecular formula C8H11Si
and a molecular weight of 135.26 g/mol.
Molecular Properties
| Compound Name | trimethyl silylcyclopentadiene |
| PubChem CID | 18322651 |
| Molecular Formula | C8H11Si |
| Molecular Weight | 135.26 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)=C([Si])C1 |
| InChI | InChI=1S/C8H11Si/c1-5-4-8(9)7(3)6(5)2/h4H2,1-3H3 |
| InChIKey | ZHRUABIHQQVHBV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl silylcyclopentadiene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl silylcyclopentadiene?
The IUPAC name of trimethyl silylcyclopentadiene (CID 18322651) is not available.
What is the SMILES notation for trimethyl silylcyclopentadiene?
The canonical SMILES for trimethyl silylcyclopentadiene is CC1=C(C)C(C)=C([Si])C1.
What is the InChIKey of trimethyl silylcyclopentadiene?
The InChIKey is ZHRUABIHQQVHBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Si/c1-5-4-8(9)7(3)6(5)2/h4H2,1-3H3.
What are the key properties of trimethyl silylcyclopentadiene?
trimethyl silylcyclopentadiene has a molecular weight of 135.26 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl silylcyclopentadiene is sourced from PubChem (CID 18322651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).