C11H14N6O6S — CID 18322717
2-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]butanedioic acid (PubChem CID 18322717) has the molecular formula C11H14N6O6S and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18322717 |
| Molecular Formula | C11H14N6O6S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[[2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetyl]amino]butanedioic acid |
| SMILES | NC(N)=Nc1nc(C(=O)NCC(=O)NC(CC(=O)O)C(=O)O)cs1 |
| InChI | InChI=1S/C11H14N6O6S/c12-10(13)17-11-16-5(3-24-11)8(21)14-2-6(18)15-4(9(22)23)1-7(19)20/h3-4H,1-2H2,(H,14,21)(H,15,18)(H,19,20)(H,22,23)(H4,12,13,16,17) |
| InChIKey | FPPODPDYKKSFQA-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 210.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|