About 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide
2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide (PubChem CID 18322948) has the molecular formula C10H12BrN5S
and a molecular weight of 314.21 g/mol. Its IUPAC name is 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide.
Molecular Properties
| Compound Name | 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide |
| PubChem CID | 18322948 |
| Molecular Formula | C10H12BrN5S |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide |
| SMILES | Br.NC(N)=Nc1nc(-c2cccc(N)c2)cs1 |
| InChI | InChI=1S/C10H11N5S.BrH/c11-7-3-1-2-6(4-7)8-5-16-10(14-8)15-9(12)13;/h1-5H,11H2,(H4,12,13,14,15);1H |
| InChIKey | ZJDSLQZEAJEZJF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide?
The IUPAC name of 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide (CID 18322948) is 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide.
What is the SMILES notation for 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide?
The canonical SMILES for 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide is Br.NC(N)=Nc1nc(-c2cccc(N)c2)cs1.
What is the InChIKey of 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide?
The InChIKey is ZJDSLQZEAJEZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5S.BrH/c11-7-3-1-2-6(4-7)8-5-16-10(14-8)15-9(12)13;/h1-5H,11H2,(H4,12,13,14,15);1H.
What are the key properties of 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide?
2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide has a molecular weight of 314.21 g/mol, XLogP of 1.88, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide is sourced from PubChem (CID 18322948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).