C11H9F5OS — CID 18323981
5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)thieno[3,2-b]pyran (PubChem CID 18323981) has the molecular formula C11H9F5OS and a molecular weight of 284.25 g/mol. Its IUPAC name is 5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)thieno[3,2-b]pyran.
| Compound Name | 5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)thieno[3,2-b]pyran |
|---|---|
| PubChem CID | 18323981 |
| Molecular Formula | C11H9F5OS |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 5,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)thieno[3,2-b]pyran |
| SMILES | CC1(C)C=Cc2sc(C(F)(F)C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C11H9F5OS/c1-9(2)4-3-7-6(17-9)5-8(18-7)10(12,13)11(14,15)16/h3-5H,1-2H3 |
| InChIKey | HHRZKOVHVAEICZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|