About ditert-butyltin(2+);methanolate
ditert-butyltin(2+);methanolate (PubChem CID 18324132) has the molecular formula C10H24O2Sn
and a molecular weight of 295.01 g/mol. Its IUPAC name is ditert-butyltin(2+);methanolate.
Molecular Properties
| Compound Name | ditert-butyltin(2+);methanolate |
| PubChem CID | 18324132 |
| Molecular Formula | C10H24O2Sn |
| Molecular Weight | 295.01 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | ditert-butyltin(2+);methanolate |
| SMILES | CC(C)(C)[Sn+2]C(C)(C)C.C[O-].C[O-] |
| InChI | InChI=1S/2C4H9.2CH3O.Sn/c2*1-4(2)3;2*1-2;/h2*1-3H3;2*1H3;/q;;2*-1;+2 |
| InChIKey | QZDTWEBSDXQIDB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.01 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ditert-butyltin(2+);methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyltin(2+);methanolate?
The IUPAC name of ditert-butyltin(2+);methanolate (CID 18324132) is ditert-butyltin(2+);methanolate.
What is the SMILES notation for ditert-butyltin(2+);methanolate?
The canonical SMILES for ditert-butyltin(2+);methanolate is CC(C)(C)[Sn+2]C(C)(C)C.C[O-].C[O-].
What is the InChIKey of ditert-butyltin(2+);methanolate?
The InChIKey is QZDTWEBSDXQIDB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9.2CH3O.Sn/c2*1-4(2)3;2*1-2;/h2*1-3H3;2*1H3;/q;;2*-1;+2.
What are the key properties of ditert-butyltin(2+);methanolate?
ditert-butyltin(2+);methanolate has a molecular weight of 295.01 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyltin(2+);methanolate is sourced from PubChem (CID 18324132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).