About 2H-pyran-4,5,6-tricarboxylic acid
2H-pyran-4,5,6-tricarboxylic acid (PubChem CID 18324278) has the molecular formula C8H6O7
and a molecular weight of 214.13 g/mol. Its IUPAC name is 2H-pyran-4,5,6-tricarboxylic acid.
Molecular Properties
| Compound Name | 2H-pyran-4,5,6-tricarboxylic acid |
| PubChem CID | 18324278 |
| Molecular Formula | C8H6O7 |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2H-pyran-4,5,6-tricarboxylic acid |
| SMILES | O=C(O)C1=CCOC(C(=O)O)=C1C(=O)O |
| InChI | InChI=1S/C8H6O7/c9-6(10)3-1-2-15-5(8(13)14)4(3)7(11)12/h1H,2H2,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | FBKJKDGWIRHYEU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-pyran-4,5,6-tricarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyran-4,5,6-tricarboxylic acid?
The IUPAC name of 2H-pyran-4,5,6-tricarboxylic acid (CID 18324278) is 2H-pyran-4,5,6-tricarboxylic acid.
What is the SMILES notation for 2H-pyran-4,5,6-tricarboxylic acid?
The canonical SMILES for 2H-pyran-4,5,6-tricarboxylic acid is O=C(O)C1=CCOC(C(=O)O)=C1C(=O)O.
What is the InChIKey of 2H-pyran-4,5,6-tricarboxylic acid?
The InChIKey is FBKJKDGWIRHYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O7/c9-6(10)3-1-2-15-5(8(13)14)4(3)7(11)12/h1H,2H2,(H,9,10)(H,11,12)(H,13,14).
What are the key properties of 2H-pyran-4,5,6-tricarboxylic acid?
2H-pyran-4,5,6-tricarboxylic acid has a molecular weight of 214.13 g/mol, XLogP of -0.55, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyran-4,5,6-tricarboxylic acid is sourced from PubChem (CID 18324278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).