C39H26F24P2 — CID 18324362
7-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylheptyl-bis[3,5-bis(trifluoromethyl)phenyl]phosphane (PubChem CID 18324362) has the molecular formula C39H26F24P2 and a molecular weight of 1012.54 g/mol. Its IUPAC name is 7-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylheptyl-bis[3,5-bis(trifluoromethyl)phenyl]phosphane.
| Compound Name | 7-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylheptyl-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 18324362 |
| Molecular Formula | C39H26F24P2 |
| Molecular Weight | 1012.54 g/mol |
| Exact Mass | 1012.11 |
| IUPAC Name | 7-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylheptyl-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
| SMILES | FC(F)(F)c1cc(P(CCCCCCCP(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H26F24P2/c40-32(41,42)20-8-21(33(43,44)45)13-28(12-20)64(29-14-22(34(46,47)48)9-23(15-29)35(49,50)51)6-4-2-1-3-5-7-65(30-16-24(36(52,53)54)10-25(17-30)37(55,56)57)31-18-26(38(58,59)60)11-27(19-31)39(61,62)63/h8-19H,1-7H2 |
| InChIKey | ZTIATYJXILAPJO-UHFFFAOYSA-N |
| XLogP | 15.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.54 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|