About N-methylethanamine;propyl prop-2-enoate
N-methylethanamine;propyl prop-2-enoate (PubChem CID 18325558) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is N-methylethanamine;propyl prop-2-enoate.
Molecular Properties
| Compound Name | N-methylethanamine;propyl prop-2-enoate |
| PubChem CID | 18325558 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | N-methylethanamine;propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC.CCNC |
| InChI | InChI=1S/C6H10O2.C3H9N/c1-3-5-8-6(7)4-2;1-3-4-2/h4H,2-3,5H2,1H3;4H,3H2,1-2H3 |
| InChIKey | HMTQZKDHSYWEFM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylethanamine;propyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylethanamine;propyl prop-2-enoate?
The IUPAC name of N-methylethanamine;propyl prop-2-enoate (CID 18325558) is N-methylethanamine;propyl prop-2-enoate.
What is the SMILES notation for N-methylethanamine;propyl prop-2-enoate?
The canonical SMILES for N-methylethanamine;propyl prop-2-enoate is C=CC(=O)OCCC.CCNC.
What is the InChIKey of N-methylethanamine;propyl prop-2-enoate?
The InChIKey is HMTQZKDHSYWEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C3H9N/c1-3-5-8-6(7)4-2;1-3-4-2/h4H,2-3,5H2,1H3;4H,3H2,1-2H3.
What are the key properties of N-methylethanamine;propyl prop-2-enoate?
N-methylethanamine;propyl prop-2-enoate has a molecular weight of 173.26 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylethanamine;propyl prop-2-enoate is sourced from PubChem (CID 18325558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).