About ethyl prop-2-enoate;propan-1-amine
ethyl prop-2-enoate;propan-1-amine (PubChem CID 18325587) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is ethyl prop-2-enoate;propan-1-amine.
Molecular Properties
| Compound Name | ethyl prop-2-enoate;propan-1-amine |
| PubChem CID | 18325587 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | ethyl prop-2-enoate;propan-1-amine |
| SMILES | C=CC(=O)OCC.CCCN |
| InChI | InChI=1S/C5H8O2.C3H9N/c1-3-5(6)7-4-2;1-2-3-4/h3H,1,4H2,2H3;2-4H2,1H3 |
| InChIKey | APJWHXYEVQNMEJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-enoate;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-enoate;propan-1-amine?
The IUPAC name of ethyl prop-2-enoate;propan-1-amine (CID 18325587) is ethyl prop-2-enoate;propan-1-amine.
What is the SMILES notation for ethyl prop-2-enoate;propan-1-amine?
The canonical SMILES for ethyl prop-2-enoate;propan-1-amine is C=CC(=O)OCC.CCCN.
What is the InChIKey of ethyl prop-2-enoate;propan-1-amine?
The InChIKey is APJWHXYEVQNMEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C3H9N/c1-3-5(6)7-4-2;1-2-3-4/h3H,1,4H2,2H3;2-4H2,1H3.
What are the key properties of ethyl prop-2-enoate;propan-1-amine?
ethyl prop-2-enoate;propan-1-amine has a molecular weight of 159.23 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-enoate;propan-1-amine is sourced from PubChem (CID 18325587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).