About butan-1-amine;propyl 2-methylprop-2-enoate
butan-1-amine;propyl 2-methylprop-2-enoate (PubChem CID 18325641) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is butan-1-amine;propyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butan-1-amine;propyl 2-methylprop-2-enoate |
| PubChem CID | 18325641 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | butan-1-amine;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.CCCCN |
| InChI | InChI=1S/C7H12O2.C4H11N/c1-4-5-9-7(8)6(2)3;1-2-3-4-5/h2,4-5H2,1,3H3;2-5H2,1H3 |
| InChIKey | GHGAMXGLERMIMK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;propyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;propyl 2-methylprop-2-enoate?
The IUPAC name of butan-1-amine;propyl 2-methylprop-2-enoate (CID 18325641) is butan-1-amine;propyl 2-methylprop-2-enoate.
What is the SMILES notation for butan-1-amine;propyl 2-methylprop-2-enoate?
The canonical SMILES for butan-1-amine;propyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCC.CCCCN.
What is the InChIKey of butan-1-amine;propyl 2-methylprop-2-enoate?
The InChIKey is GHGAMXGLERMIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C4H11N/c1-4-5-9-7(8)6(2)3;1-2-3-4-5/h2,4-5H2,1,3H3;2-5H2,1H3.
What are the key properties of butan-1-amine;propyl 2-methylprop-2-enoate?
butan-1-amine;propyl 2-methylprop-2-enoate has a molecular weight of 201.31 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;propyl 2-methylprop-2-enoate is sourced from PubChem (CID 18325641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).