C10H17NO2 — CID 18325692
3,3,4,4-tetramethyl-1-propanoylazetidin-2-one (PubChem CID 18325692) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-1-propanoylazetidin-2-one.
| Compound Name | 3,3,4,4-tetramethyl-1-propanoylazetidin-2-one |
|---|---|
| PubChem CID | 18325692 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3,3,4,4-tetramethyl-1-propanoylazetidin-2-one |
| SMILES | CCC(=O)N1C(=O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C10H17NO2/c1-6-7(12)11-8(13)9(2,3)10(11,4)5/h6H2,1-5H3 |
| InChIKey | FFDZNUJWCDQSNU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |