C17H20F5N3O2S — CID 18326149
N-ethyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 18326149) has the molecular formula C17H20F5N3O2S and a molecular weight of 425.42 g/mol. Its IUPAC name is N-ethyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)acetamide.
| Compound Name | N-ethyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 18326149 |
| Molecular Formula | C17H20F5N3O2S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-ethyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,5,5-trimethylcyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CCN(C(=O)COc1nnc(C(F)(F)C(F)(F)F)s1)C1=CC(C)=CC(C)(C)C1 |
| InChI | InChI=1S/C17H20F5N3O2S/c1-5-25(11-6-10(2)7-15(3,4)8-11)12(26)9-27-14-24-23-13(28-14)16(18,19)17(20,21)22/h6-7H,5,8-9H2,1-4H3 |
| InChIKey | UIXIFCZBMPMHID-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|