C18H22F5N3O2S — CID 18326165
2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 18326165) has the molecular formula C18H22F5N3O2S and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | 2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 18326165 |
| Molecular Formula | C18H22F5N3O2S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC1=CC(N(C(=O)COc2nnc(C(F)(F)C(F)(F)F)s2)C(C)C)=CC(C)(C)C1 |
| InChI | InChI=1S/C18H22F5N3O2S/c1-10(2)26(12-6-11(3)7-16(4,5)8-12)13(27)9-28-15-25-24-14(29-15)17(19,20)18(21,22)23/h6,8,10H,7,9H2,1-5H3 |
| InChIKey | JIAFGNUSAKNAMC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|