C17H20F3N3O2S — CID 18326172
N-cyclopropyl-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 18326172) has the molecular formula C17H20F3N3O2S and a molecular weight of 387.43 g/mol. Its IUPAC name is N-cyclopropyl-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-cyclopropyl-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 18326172 |
| Molecular Formula | C17H20F3N3O2S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-cyclopropyl-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC1=CC(N(C(=O)COc2nnc(C(F)(F)F)s2)C2CC2)=CC(C)(C)C1 |
| InChI | InChI=1S/C17H20F3N3O2S/c1-10-6-12(8-16(2,3)7-10)23(11-4-5-11)13(24)9-25-15-22-21-14(26-15)17(18,19)20/h6,8,11H,4-5,7,9H2,1-3H3 |
| InChIKey | AYPRLDJEQDQPSF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |