About 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride
1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride (PubChem CID 18326505) has the molecular formula C15H22ClN5OS
and a molecular weight of 355.90 g/mol. Its IUPAC name is 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride |
| PubChem CID | 18326505 |
| Molecular Formula | C15H22ClN5OS |
| Molecular Weight | 355.90 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride |
| SMILES | C=CCNc1nc(NC(=O)NC(C)(C)C)c2scc(C)c2n1.Cl |
| InChI | InChI=1S/C15H21N5OS.ClH/c1-6-7-16-13-17-10-9(2)8-22-11(10)12(18-13)19-14(21)20-15(3,4)5;/h6,8H,1,7H2,2-5H3,(H3,16,17,18,19,20,21);1H |
| InChIKey | AWVLIQNJALOEGJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.90 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride?
The IUPAC name of 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride (CID 18326505) is 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride.
What is the SMILES notation for 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride?
The canonical SMILES for 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride is C=CCNc1nc(NC(=O)NC(C)(C)C)c2scc(C)c2n1.Cl.
What is the InChIKey of 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride?
The InChIKey is AWVLIQNJALOEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5OS.ClH/c1-6-7-16-13-17-10-9(2)8-22-11(10)12(18-13)19-14(21)20-15(3,4)5;/h6,8H,1,7H2,2-5H3,(H3,16,17,18,19,20,21);1H.
What are the key properties of 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride?
1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride has a molecular weight of 355.90 g/mol, XLogP of 3.94, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[7-methyl-2-(prop-2-enylamino)thieno[3,2-d]pyrimidin-4-yl]urea;hydrochloride is sourced from PubChem (CID 18326505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).