About cyclopenta[c]pyrrole
cyclopenta[c]pyrrole (PubChem CID 18326642) has the molecular formula C7H5N
and a molecular weight of 103.12 g/mol. Its IUPAC name is cyclopenta[c]pyrrole.
Molecular Properties
| Compound Name | cyclopenta[c]pyrrole |
| PubChem CID | 18326642 |
| Molecular Formula | C7H5N |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.04 |
| IUPAC Name | cyclopenta[c]pyrrole |
| SMILES | C1=CC2=CN=CC2=C1 |
| InChI | InChI=1S/C7H5N/c1-2-6-4-8-5-7(6)3-1/h1-5H |
| InChIKey | NNHOUIKFCCIVCI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopenta[c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[c]pyrrole?
The IUPAC name of cyclopenta[c]pyrrole (CID 18326642) is cyclopenta[c]pyrrole.
What is the SMILES notation for cyclopenta[c]pyrrole?
The canonical SMILES for cyclopenta[c]pyrrole is C1=CC2=CN=CC2=C1.
What is the InChIKey of cyclopenta[c]pyrrole?
The InChIKey is NNHOUIKFCCIVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N/c1-2-6-4-8-5-7(6)3-1/h1-5H.
What are the key properties of cyclopenta[c]pyrrole?
cyclopenta[c]pyrrole has a molecular weight of 103.12 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[c]pyrrole is sourced from PubChem (CID 18326642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).